| Overview |
| bs-16042R-APC |
| Phospho-MAP2 (Thr1613/1619) Polyclonal Antibody, APC Conjugated |
| IF(IHC-P), IF(IHC-F), IF(ICC) |
| Human, Mouse, Rat |
| Dog, Cow, Pig, Horse, Chicken, Rabbit |
| Specifications |
| APC |
| Rabbit |
| KLH conjugated synthesised phosphopeptide derived from human MAP2 around the phosphorylation site of Thr1613 and Thr1619 |
| Thr1613/1619 |
| Polyclonal |
| #REF! |
| IgG |
| 1ug/ul |
| Purified by Protein A. |
| Aqueous buffered solution containing 0.01M TBS (pH7.4) with 1% BSA, 0.02% Proclin300 and 50% Glycerol. |
| Store at -20C. Aliquot into multiple vials to avoid repeated freeze-thaw cycles. |
| Target |
| 4133 |
| P11137 |
| Cytoplasm |
| MAP2(Phospho Thr1613/1619); MAP2 (phospho Thr1613/1619); p-MAP2 (phospho Thr1613/1619); MAP2(Phospho Thr1613/1619); MAP2(Phospho-Thr1613/1619); p-MAP2(Phospho-Thr1613/1619); DKFZp686I2148; Dendrite specific MAP; DKFZp686I2148; MAP 2; MAP-2; MAP2; MAP2_HUMAN; MAP2A; MAP2B; MAP2C; Microtubule associated protein 2; Microtubule-associated protein 2; Mtap 2. |
| MAP2 is the major microtubule associated protein of brain tissue. There are three forms of MAP2; two are similarily sized with apparent molecular weights of 280 kDa (MAP2a and MAP2b) and the third with a lower molecular weight of 70 kDa (MAP2c). In the newborn rat brain, MAP2b and MAP2c are present, while MAP2a is absent. Between postnatal days 10 and 20, MAP2a appears. At the same time, the level of MAP2c drops by 10-fold. This change happens during the period when dendrite growth is completed and when neurons have reached their mature morphology. MAP2 is degraded by a Cathepsin D-like protease in the brain of aged rats. There is some indication that MAP2 is expressed at higher levels in some types of neurons than in other types. MAP2 is known to promote microtubule assembly and to form side-arms on microtubules. It also interacts with neurofilaments, actin, and other elements of the cytoskeleton. |
| Application Dilution |
| IF(IHC-P) |
1:50-200 |
| IF(IHC-F) |
1:50-200 |
| IF(ICC) |
1:50-200 |