Pseudolaric acid B
| Overview | |
| Catalog # | bs-75073c-100ug |
| Product Name | Pseudolaric acid B |
| Specifications | |
| Storage Buffer | Solid |
| Storage Condition | Stable for 2 years after receipt when stored at +4°C. |
| Target | |
| Product Information | CAS Number: 82508-31-4 Molecular formula: C23H28O8 Molecular weight: 432.5 Purity: >98% (HPLC) Appearance: White to off-white solid. Solubility: Soluble in DMSO, ethanol, methanol or chloroform. InChiKey: VDGOFNMYZYBUDT-YDRCMHEVSA-N SMILES: [H][C@@]12CC[C@]3(CC=C(CC[C@]13OC(C)=O)C(=O)OC)C(=O)O[C@]2(C)\C=C\C=C(/C)C(O)=O |
| Description | Antifungal and antifertility compound [1, 3]. Antitumor compound [2, 7-9, 13]. PPARalpha signaling agonist [4]. Angiogenesis inhibitor [5, 6, 11]. Apoptosis and autophagy inducer [7, 9, 15, 17]. Microtubule-destabilizing agent [8, 11]. Anti-inflammatory. Inhibits NF-kappaB and p38 signaling [12, 14]. Immunosuppressive [16]. |