Z-Leu-Leu-Leu-CHO [MG-132]
| Overview | |
| Catalog # | bs-75297c-1mg |
| Product Name | Z-Leu-Leu-Leu-CHO [MG-132] |
| Specifications | |
| Storage Buffer | Solid |
| Storage Condition | Stable for 2 years after receipt when stored at -20°C. |
| Target | |
| Product Information | CAS Number: 133407-82-6 Molecular formula: C26H41N3O5 Molecular weight: 475.6 Purity: >97% (HPLC) Appearance: White solid. Solubility: Soluble in DMSO or ethanol. InChiKey: TZYWCYJVHRLUCT-VABKMULXSA-N SMILES: [H]C(=O)[C@]([H])(CC(C)C)NC(=O)[C@]([H])(CC(C)C)NC(=O)[C@]([H])(CC(C)C)NC(=O)OCC1=CC=CC=C1 |
| Description | Potent, cell permeable and selective, reversible proteasome inhibitor [2, 7]. Blocks degradation of short-lived proteins and induces a heat shock response [2, 6, 7]. NF-kappaB activation inhibitor through IkappaB degradation [3, 8]. Cell permeable, reversible peptide aldehyde inhibitor. Calpain and cathepsin inhibitor [4, 11]. Has anticancer properties by inducing cell cycle arrest and activating apoptosis in various cancer cell lines [8, 9, 12,13,15]. Has adjuvant/chemosensitizer potential [8]. Neurite outgrowth stimulator in PC12 cells [1]. Prevents beta-secretase cleavage [5, 10]. Autophagy activator [12, 14]. |