Butyrolactone 3
| Overview | |
| Catalog # | bs-75447c-2mg |
| Product Name | Butyrolactone 3 |
| Specifications | |
| Storage Buffer | Solid |
| Storage Condition | Stable for 2 years after receipt when stored at -20°C. |
| Target | |
| Product Information | CAS Number: 778649-18-6 Molecular formula: C9H12O4 Molecular weight: 184.2 Purity: >95% (NMR) Appearance: White to off-white solid. Solubility: Soluble in DMSO or methanol. InChiKey: SRQUTZJZABSZRQ-NKWVEPMBSA-N SMILES: CCC[C@@H]1OC(=O)C(=C)[C@H]1C(O)=O |
| Description | Specific histone acetyltransferase Gcn5 inhibitor [1, 2]. Anticancer compound [2, 4]. Pre-mRNA splicing inhibitor. Blocks splicing before the first catalytic steps [3]. Potential anti-inflammatory compound. |