Atpenin A5
| Overview | |
| Catalog # | bs-75082c-1mg |
| Product Name | Atpenin A5 |
| Specifications | |
| Storage Buffer | Solid |
| Storage Condition | Stable for 3 years after receipt when stored at -20°C. |
| Target | |
| Product Information | CAS Number: 119509-24-9 Molecular formula: C15H21Cl2NO5 Molecular weight: 366.2 Purity: >95% (HPLC) Appearance: White to off-white solid. Solubility: Soluble in acetone, acetonitrile, chloroform, ethyl acetate, DMSO, methanol or ethanol. Insoluble in water or hexane. InChiKey: OVULNOOPECCZRG-CIUDSAMLSA-N SMILES: COC1=C(OC)C(O)=C(C(=O)[C@@H](C)C[C@H](C)[C@@H](Cl)CCl)C(O)=N1 |
| Description | Antibiotic [1-3]. Antifungal [1-3]. Potent and specific mitochondrial complex II (succinate-ubiquinone oxidoreductase) inhibitor [4, 5, 7]. Mitochondrial ATP-sensitive potassium (mK(ATP)) channel activator [6, 8]. Cardioprotective [6, 8]. Modulates mitochondrial ROS generation during cardioprotection [9]. |