Malformin C
| Overview | |
| Catalog # | bs-75089c-1mg |
| Product Name | Malformin C |
| Specifications | |
| Storage Buffer | Solid |
| Storage Condition | Stable for 3 years after receipt when stored at -20°C. |
| Target | |
| Product Information | CAS Number: 59926-78-2 Molecular formula: C23H39N5O5S2 Molecular weight: 529.7 Purity: >95% (HPLC) Appearance: White solid. Solubility: Soluble in DMSO, methanol, ethanol or chloroform. Insoluble in water. InChiKey: TZODYIWCRGWHQB-TZNCUMHOSA-N SMILES: CC(C)C[C@@H]1NC(=O)[C@@H](CC(C)C)NC(=O)[C@@H](NC(=O)[C@H]2CSSC[C@@H](NC1=O)C(=O)N2)C(C)C |
| Description | Peptide antibiotic [1]. Induces root curvature and malformation in plants [1]. Antibacterial [1, 2], antimalarial and antitrypanosomal [4]. Disrupts the cell cycle at the G2 checkpoint of cancer cells, leading to sensitization of the cancer cells to anti-cancer reagents [3]. |