Dihydrochlamydocin
| Overview | |
| Catalog # | bs-75096c-1mg |
| Product Name | Dihydrochlamydocin |
| Specifications | |
| Storage Buffer | Solid |
| Storage Condition | Stable for 3 years after receipt when stored at -20°C. |
| Target | |
| Product Information | CAS Number: 157618-75-2 Molecular formula: C28H40N4O6 Molecular weight: 528.7 Purity: >95% (HPLC) Appearance: Off-white solid. Solubility: Soluble in DMSO, ethanol or methanol. InChiKey: UXOLDMJAFJDQSE-MEJZKDKBBV SMILES: CC1(C)NC(=O)[C@H](CCCCCC(O)C2CO2)NC(=O)[C@H]2CCCN2C(=O)[C@H](CC2=CC=CC=C2)NC1=O |
| Description | Phytotoxin [1-3, 5]. Derivative of HDAC inhibitor chlamydocin [1-3, 5] Similar chemical structure to the TAN-1746 compounds (potent HDAC inhibitors) [4]. |