BE-31405
| Overview | |
| Catalog # | bs-75161c-1mg |
| Product Name | BE-31405 |
| Specifications | |
| Storage Buffer | Powder |
| Storage Condition | Stable for 2 years after receipt when stored at -20°C. |
| Target | |
| Product Information | CAS Number: 158054-02-5 Molecular formula: C28H36O10 Molecular weight: 532.6 Purity: >98% (HPLC) Appearance: White to off-white powder. Solubility: Soluble in DMSO. InChiKey: ULHRLJDDVCQHQE-IXWUSAGWSA-N SMILES: C[C@H](CC1)[C@]2([H])[C@]1([H])[C@]3(C=O)[C@](C(C(C)C)=C4)(C(O)=O)[C@]([C@@H]4C3)(CO[C@@]5(O6)O[C@]7([H])[C@@]6([H])O[C@H]([C@@H]5O)[C@H]7OC(C)=O)C2 |
| Description | Broad spectrum antifungal agent compared to sordarin. Shows growth inhibitory activity against pathogenic fungal strains such as Candida albicans, C. glabrata and Cryptococcus neoformans. Inhibits the protein synthesis in C. albicans, but not mammalian cells, most probably through elongation factor inhibition. |