NU6102
| Overview | |
| Catalog # | bs-75354c-1mg |
| Product Name | NU6102 |
| Specifications | |
| Storage Buffer | Solid |
| Storage Condition | Stable for 2 years after receipt when stored at -20°C. |
| Target | |
| Product Information | CAS Number: 444722-95-6 Molecular formula: C18H22N6O3S Molecular weight: 402.5 Purity: >98% (NMR) Appearance: White to off-white solid. Solubility: Soluble in DMSO. InChiKey: OWXORKPNCHJYOF-UHFFFAOYSA-N SMILES: NS(=O)(=O)C1=CC=C(NC2=NC3=C(N=CN3)C(OCC3CCCCC3)=N2)C=C1 |
| Description | Potent CDK1/cyclin B (IC50 = 9.5 nM) and CDK2/cyclin A3 (IC50 = 5.4 nM) inhibitor [1-3]. 1'000-fold more potent than NU2058 [1]. Selective for CDK1 and CDK2 compared to CDK4/D1 (IC50 = 1.6 µM), DYRK1A (IC50 = 0.9 µM), PDK1 (IC50 = 0.8 µM) and ROCK-II (IC50 = 0.6 µM) [1]. Inhibits cell growth [1]. |