NSC697923
| Overview | |
| Catalog # | bs-75444c-1mg |
| Product Name | NSC697923 |
| Specifications | |
| Storage Buffer | Solid |
| Storage Condition | Stable for 2 years after receipt when stored at -20°C. |
| Target | |
| Product Information | CAS Number: 343351-67-7 Molecular formula: C11H9NO5S Molecular weight: 267.3 Purity: >98% (NMR) Appearance: White solid. Solubility: Soluble in DMSO. InChiKey: GAUHIPWCDXOLCZ-UHFFFAOYAJ SMILES: CC1=CC=C(C=C1)S(=O)(=O)C1=CC=C(O1)[N+]([O-])=O |
| Description | Selective Ub-conjugating enzyme (E2) complex Ubc13-Uev1A inhibitor. Inhibits the formation of the Ubc13~Ub conjugate. NF-kappaB activation inhibitor. Inhibits proliferation and survival of ABC-DLBCL and GCB-DLBCL (diffuse large B cell lymphoma) cells. |