Tripolin B
| Overview | |
| Catalog # | bs-75446c-1mg |
| Product Name | Tripolin B |
| Specifications | |
| Storage Buffer | Solid |
| Storage Condition | Stable for 2 years after receipt when stored at -20°C. Store solutions at -20°C in the dark. |
| Target | |
| Product Information | CAS Number: 372164-71-1 Molecular formula: C12H9N3O Molecular weight: 211.2 Purity: >98% (NMR) Appearance: Yellow solid. Solubility: Soluble in DMSO (at least 5 mg/ml). InChiKey: VEEGZPWAAPPXRB-YHYXMXQVSA-N SMILES: O=C1NC2=C(C=CC=C2)\C1=C\C1=CN=CN1 |
| Description | Aurora A and B modulator [1]. |
Powered by Bioz