3-(4-Aminophenyl)-7-(diethylamino)-4-methyl-2H-1- benzopyran-2-one
| Overview | |
| Catalog # | bs-75898c-100mg |
| Product Name | 3-(4-Aminophenyl)-7-(diethylamino)-4-methyl-2H-1- benzopyran-2-one |
| Specifications | |
| Storage Buffer | Powder |
| Storage Condition | Stable for 2 years after receipt when stored at -20°C. |
| Target | |
| Product Information | CAS Number: 36840-64-9 Molecular formula: C20H22N2O2 Molecular weight: 322.4 Purity: >90% (NMR) Appearance: Odorless dry yellow powder. Solubility: Soluble in DMF. InChiKey: JTLLWYHHWFGIPB-UHFFFAOYSA-N SMILES: O=C1C(C2=CC=C(N)C=C2)=C(C)C3=CC=C(N(CC)CC)C=C3O1 |
| Description | Fluorogenic amine label used for the synthesis of fluorescent reagents. Spectral Data: lambdaex = 396nm; lambdaem = 480nm (in DMF, Lit). |
Powered by Bioz