BEP
| Overview | |
| Catalog # | bs-75910c-1g |
| Product Name | BEP |
| Specifications | |
| Storage Buffer | Powder |
| Storage Condition | Stable for 2 years after receipt when stored at -20°C. |
| Target | |
| Product Information | CAS Number: 878-23-9 Molecular formula: C7H9BBrF4N Molecular weight: 273.86 Purity: >97% (HPLC) Appearance: White powder. Solubility: Soluble in water. InChiKey: YJDXVQLBIAJTHP-UHFFFAOYSA-N SMILES: [F-].FB(F)F.CC[N]1=C(Br)C=CC=C1 |
| Description | Efficient coupling reagent for the synthesis of sterically hindered amides, especially peptides. In terms of reactivity and racemization-suppressing capability, this pyridinium-type reagent, BEP, proved to be more efficient than commonly used uronium- and phosphonium-type reagents, such as HBTU, BOP, and PyBroP, for the synthesis of hindered peptides containing N-methylated or Calpha,Calpha-dialkylated amino acid residues. BEP was also proven to be an efficient reagent for the synthesis of esters, especially active esters and hindered esters, and tert-butyl esters. |