3,3'-Dipropylthiacarbocyanine iodide
| Overview | |
| Catalog # | bs-76106c-250mg |
| Product Name | 3,3'-Dipropylthiacarbocyanine iodide |
| Specifications | |
| Storage Buffer | Solid |
| Storage Condition | Stable for 2 years after receipt when stored at -20°C. |
| Target | |
| Product Information | CAS Number: 53336-12-2 Molecular formula: C23H25IN2S2 Molecular weight: 520.49 Purity: >98% (NMR) Appearance: Solid. Solubility: Soluble in methanol, DMSO or DMF. InChiKey: JGTCEHAVVINOPG-UHFFFAOYSA-M SMILES: [I-].CCCN1\C(SC2=C1C=CC=C2)=C/C=C/C1=[N+](CCC)C2=C(S1)C=CC=C2 |
| Description | Carbocyanine dyes, particularly thiacyanines such as DiSC3(3) can inhibit respiration and may therefore be relatively cytotoxic. 3,3'-dipropyl-thiadicarbocyanine iodide is sensitive to membrane potential, fluorescence response to depolarization depends on the staining concentration and detection method. Selected applications are: -Calcium channels and other ion transport systems -Mitochondrial activity -Neurons and brain tissue -Membrane potential in intact yeast cells |
Powered by Bioz