Receive 30% off all Monoclonal IHC antibodies with code "MONO-IHC-30"! Offer valid for US customers and available internationally through distributors.

Dansyl hydrazine

Overview
Catalog # bs-76166c-1g
Product Name Dansyl hydrazine
Specifications
Storage Buffer Powder
Storage Condition Stable for 2 years after receipt when stored at -20°C.
Target
Product Information CAS Number: 33008-06-9

Molecular formula: C12H15N3O2S

Molecular weight: 265.33

Purity: >95% (HPLC)

Appearance: White to light yellow powder or crystals.

Solubility: Soluble in ethanol or methanol.

InChiKey: KPQYDVAFRDWIBW-UHFFFAOYSA-N

SMILES: CN(C)c1cccc2c(cccc12)S(=O)(=O)NN

SMILES: CN(C)C1=CC=CC2=C1C=CC=C2S(=O)(=O)NN
Description Dansyl hydrazine is a short-wavelength, UV-excited, fluorescent dye that has various applications in chemistry and biochemistry. It is a derivative of dansyl chloride, a compound commonly used for labeling and detecting amines and amino acids. Dansyl hydrazine itself is often employed for similar purposes. Dansyl hydrazine can be used to label primary and secondary amines in molecules, such as proteins and peptides. This labeling is useful for various applications, including protein analysis and drug development. Dansyl hydrazine is used to derivatize amino acids, making them more amenable to analysis by techniques like high-performance liquid chromatography (HPLC) and mass spectrometry (MS). This allows for the quantification and identification of amino acids in complex biological samples. Dansyl hydrazine can react with carbonyl compounds, such as ketones and aldehydes, to form dansyl hydrazones. This reaction can be used to detect and quantify carbonyl-containing compounds in various samples. Dansyl hydrazine labeling can be employed to study protein structure and function. By attaching dansyl hydrazine to specific sites on a protein, researchers can monitor conformational changes and protein-protein interactions. Spectral Data: lambdaex 340 nm, lambdaem 525 nm (in ethanol); lambdaex 336 nm, lambdaem 534 nm (in methanol).