Triphenyltetrazolium chloride
| Overview | |
| Catalog # | bs-76807c-25g |
| Product Name | Triphenyltetrazolium chloride |
| Specifications | |
| Storage Buffer | Powder |
| Storage Condition | Stable for 2 years after receipt when stored at +4°C. |
| Target | |
| Product Information | CAS Number: 298-96-4 Molecular formula: C19H15ClN4 Molecular weight: 334.8 Purity: >99% (Argentometric Titration) Appearance: Off-white to yellow powder. Solubility: Soluble in acetone or methanol. InChiKey: PKDBCJSWQUOKDO-UHFFFAOYSA-M SMILES: [Cl-].C1=CC=C(C=C1)N1N=C(N=[N+]1C1=CC=CC=C1)C1=CC=CC=C1 SMILES: [Cl-].C1=CC=C(C=C1)N1N=C(N=[N+]1C1=CC=CC=C1)C1=CC=CC=C1 |
| Description | Triphenyl tetrazolium chloride, TTC, or simply tetrazolium chloride is a redox indicator commonly used in biochemical experiments especially to indicate cellular respiration. |