1,2,3-Tris(diethylamino)cyclopropenylium bis(trifluoromethanesulfonyl)imide
| Overview | |
| Catalog # | bs-76823c-1g |
| Product Name | 1,2,3-Tris(diethylamino)cyclopropenylium bis(trifluoromethanesulfonyl)imide |
| Specifications | |
| Storage Buffer | Liquid |
| Storage Condition | Stable for 2 years after receipt when stored at -20°C. |
| Target | |
| Product Information | CAS Number: 1333477-58-9 Molecular formula: C17H30F6N4O4S2 Molecular weight: 532.56 Purity: >97% (HPLC) Appearance: Yellow liquid. Solubility: Soluble in water. InChiKey: SWRHBXSDADDWGZ-UHFFFAOYSA-N SMILES: FC(F)(F)S(=O)(=O)[N-]S(=O)(=O)C(F)(F)F.CCN(CC)C1=C(N(CC)CC)C1=[N+](CC)CC |
| Description | Air- and water-stable ionic liquid. The properties of these ionic liquids include almost zero vapour pressure, low flammability and ease of recycling. They are frequently considered as potential green alternatives to classical organic solvents. Additionally, most classes can be readily tuned to provide unique solvent environments in which to carry out reactions, extractions and other processes. There are a large number of applications. |
Powered by Bioz