Fluorescin
| Overview | |
| Catalog # | bs-76192c-5g |
| Product Name | Fluorescin |
| Specifications | |
| Storage Buffer | Powder |
| Storage Condition | Stable for 2 years after receipt when stored at +4°C. |
| Target | |
| Product Information | CAS Number: 518-44-5 Molecular formula: C20 H14 O5 Molecular weight: 334.32 Purity: >97% (NMR) Appearance: Orange to brown powder. Solubility: Slightly soluble in water. InChiKey: MURGITYSBWUQTI-UHFFFAOYSA-N SMILES: OC(=O)C1=CC=CC=C1C1C2=C(OC3=C1C=CC(O)=C3)C=C(O)C=C2 SMILES: OC(=O)C1=C(C=CC=C1)C1C2=C(OC3=C1C=CC(O)=C3)C=C(O)C=C2 |
| Description | Fluorescent probe in biology used to detect protein location and activation, identify protein complex formation and conformational changes and monitor biological processes in vitro or in vivo. |
Powered by Bioz